C11H11N3S — CID 103578173
N-pent-1-yn-3-ylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 103578173) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is N-pent-1-yn-3-ylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-pent-1-yn-3-ylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103578173 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-pent-1-yn-3-ylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | C#CC(CC)Nc1ncnc2ccsc12 |
| InChI | InChI=1S/C11H11N3S/c1-3-8(4-2)14-11-10-9(5-6-15-10)12-7-13-11/h1,5-8H,4H2,2H3,(H,12,13,14) |
| InChIKey | QQYGUFPVHLSAHJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|