C12H11N3OS — CID 41131806
N-[(1R)-1-(furan-2-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 41131806) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 41131806 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | C[C@@H](Nc1ncnc2ccsc12)c1ccco1 |
| InChI | InChI=1S/C12H11N3OS/c1-8(10-3-2-5-16-10)15-12-11-9(4-6-17-11)13-7-14-12/h2-8H,1H3,(H,13,14,15)/t8-/m1/s1 |
| InChIKey | ZBYWOALXTKURIQ-MRVPVSSYSA-N |
| XLogP | 3.46 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |