C11H15N3S — CID 43236191
N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 43236191) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 43236191 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCCC(C)Nc1ncnc2ccsc12 |
| InChI | InChI=1S/C11H15N3S/c1-3-4-8(2)14-11-10-9(5-6-15-10)12-7-13-11/h5-8H,3-4H2,1-2H3,(H,12,13,14) |
| InChIKey | GOXXIOHZWNUPEL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |