C12H17N3S — CID 102686212
7-methyl-N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 102686212) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 7-methyl-N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-methyl-N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 102686212 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 7-methyl-N-pentan-2-ylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCCC(C)Nc1ncnc2c(C)csc12 |
| InChI | InChI=1S/C12H17N3S/c1-4-5-9(3)15-12-11-10(13-7-14-12)8(2)6-16-11/h6-7,9H,4-5H2,1-3H3,(H,13,14,15) |
| InChIKey | ISNJBAKJBKRAQL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |