C11H16N4S — CID 62663575
N'-propan-2-yl-N-thieno[3,2-d]pyrimidin-4-ylethane-1,2-diamine (PubChem CID 62663575) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is N'-propan-2-yl-N-thieno[3,2-d]pyrimidin-4-ylethane-1,2-diamine.
| Compound Name | N'-propan-2-yl-N-thieno[3,2-d]pyrimidin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62663575 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N'-propan-2-yl-N-thieno[3,2-d]pyrimidin-4-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNc1ncnc2ccsc12 |
| InChI | InChI=1S/C11H16N4S/c1-8(2)12-4-5-13-11-10-9(3-6-16-10)14-7-15-11/h3,6-8,12H,4-5H2,1-2H3,(H,13,14,15) |
| InChIKey | ADPJSYIFJCTYPY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|