About 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol
2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol (PubChem CID 58265115) has the molecular formula C8H9N3S2
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol.
Molecular Properties
| Compound Name | 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol |
| PubChem CID | 58265115 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol |
| SMILES | SCCNc1ncnc2ccsc12 |
| InChI | InChI=1S/C8H9N3S2/c12-3-2-9-8-7-6(1-4-13-7)10-5-11-8/h1,4-5,12H,2-3H2,(H,9,10,11) |
| InChIKey | ZTCHUKDSENFGSZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol?
The IUPAC name of 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol (CID 58265115) is 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol.
What is the SMILES notation for 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol?
The canonical SMILES for 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol is SCCNc1ncnc2ccsc12.
What is the InChIKey of 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol?
The InChIKey is ZTCHUKDSENFGSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S2/c12-3-2-9-8-7-6(1-4-13-7)10-5-11-8/h1,4-5,12H,2-3H2,(H,9,10,11).
What are the key properties of 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol?
2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol has a molecular weight of 211.31 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanethiol is sourced from PubChem (CID 58265115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).