C11H15N3OS — CID 66108387
3-methyl-4-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol (PubChem CID 66108387) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 3-methyl-4-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol.
| Compound Name | 3-methyl-4-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 66108387 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-methyl-4-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol |
| SMILES | CC(CCO)CNc1ncnc2ccsc12 |
| InChI | InChI=1S/C11H15N3OS/c1-8(2-4-15)6-12-11-10-9(3-5-16-10)13-7-14-11/h3,5,7-8,15H,2,4,6H2,1H3,(H,12,13,14) |
| InChIKey | BVKXTZVHWLEBMB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |