C13H11N3OS — CID 113228774
2-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]phenol (PubChem CID 113228774) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]phenol.
| Compound Name | 2-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 113228774 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNc1ncnc2ccsc12 |
| InChI | InChI=1S/C13H11N3OS/c17-11-4-2-1-3-9(11)7-14-13-12-10(5-6-18-12)15-8-16-13/h1-6,8,17H,7H2,(H,14,15,16) |
| InChIKey | JDYSWNATWCHDOF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|