C14H13N3OS — CID 102686720
2-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenol (PubChem CID 102686720) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenol.
| Compound Name | 2-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 102686720 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)amino]methyl]phenol |
| SMILES | Cc1csc2c(NCc3ccccc3O)ncnc12 |
| InChI | InChI=1S/C14H13N3OS/c1-9-7-19-13-12(9)16-8-17-14(13)15-6-10-4-2-3-5-11(10)18/h2-5,7-8,18H,6H2,1H3,(H,15,16,17) |
| InChIKey | GEDOJESWLPJBQL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|