C12H17N3OS — CID 102686662
7-methyl-N-(2-propan-2-yloxyethyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 102686662) has the molecular formula C12H17N3OS and a molecular weight of 251.36 g/mol. Its IUPAC name is 7-methyl-N-(2-propan-2-yloxyethyl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-methyl-N-(2-propan-2-yloxyethyl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 102686662 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 7-methyl-N-(2-propan-2-yloxyethyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Cc1csc2c(NCCOC(C)C)ncnc12 |
| InChI | InChI=1S/C12H17N3OS/c1-8(2)16-5-4-13-12-11-10(14-7-15-12)9(3)6-17-11/h6-8H,4-5H2,1-3H3,(H,13,14,15) |
| InChIKey | QMCAISNYRQUZFH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|