C10H13N3OS — CID 93033856
(2S)-2-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol (PubChem CID 93033856) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is (2S)-2-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol.
| Compound Name | (2S)-2-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 93033856 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (2S)-2-(thieno[3,2-d]pyrimidin-4-ylamino)butan-1-ol |
| SMILES | CC[C@@H](CO)Nc1ncnc2ccsc12 |
| InChI | InChI=1S/C10H13N3OS/c1-2-7(5-14)13-10-9-8(3-4-15-9)11-6-12-10/h3-4,6-7,14H,2,5H2,1H3,(H,11,12,13)/t7-/m0/s1 |
| InChIKey | KNUIJMDUQHEJNI-ZETCQYMHSA-N |
| XLogP | 1.87 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |