C11H11N5S — CID 103853810
N-[1-(1H-pyrazol-4-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 103853810) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is N-[1-(1H-pyrazol-4-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[1-(1H-pyrazol-4-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103853810 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-[1-(1H-pyrazol-4-yl)ethyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | CC(Nc1ncnc2ccsc12)c1cn[nH]c1 |
| InChI | InChI=1S/C11H11N5S/c1-7(8-4-14-15-5-8)16-11-10-9(2-3-17-10)12-6-13-11/h2-7H,1H3,(H,14,15)(H,12,13,16) |
| InChIKey | BYKBCRGHSZHYKI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |