C26H34N4O3 — CID 157383740
(5R)-5-[[2-[(2,4-dimethoxyphenyl)methylamino]quinazolin-4-yl]amino]nonan-2-one (PubChem CID 157383740) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is (5R)-5-[[2-[(2,4-dimethoxyphenyl)methylamino]quinazolin-4-yl]amino]nonan-2-one.
| Compound Name | (5R)-5-[[2-[(2,4-dimethoxyphenyl)methylamino]quinazolin-4-yl]amino]nonan-2-one |
|---|---|
| PubChem CID | 157383740 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (5R)-5-[[2-[(2,4-dimethoxyphenyl)methylamino]quinazolin-4-yl]amino]nonan-2-one |
| SMILES | CCCC[C@H](CCC(C)=O)Nc1nc(NCc2ccc(OC)cc2OC)nc2ccccc12 |
| InChI | InChI=1S/C26H34N4O3/c1-5-6-9-20(14-12-18(2)31)28-25-22-10-7-8-11-23(22)29-26(30-25)27-17-19-13-15-21(32-3)16-24(19)33-4/h7-8,10-11,13,15-16,20H,5-6,9,12,14,17H2,1-4H3,(H2,27,28,29,30)/t20-/m1/s1 |
| InChIKey | PJQXBWKQHCKAAC-HXUWFJFHSA-N |
| XLogP | 5.60 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |