C23H28F3N5O3 — CID 122585386
(2R,3R)-3-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-1,1,1-trifluoroheptan-2-ol (PubChem CID 122585386) has the molecular formula C23H28F3N5O3 and a molecular weight of 479.50 g/mol. Its IUPAC name is (2R,3R)-3-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-1,1,1-trifluoroheptan-2-ol.
| Compound Name | (2R,3R)-3-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-1,1,1-trifluoroheptan-2-ol |
|---|---|
| PubChem CID | 122585386 |
| Molecular Formula | C23H28F3N5O3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (2R,3R)-3-[[2-[(2,4-dimethoxyphenyl)methylamino]pyrido[3,2-d]pyrimidin-4-yl]amino]-1,1,1-trifluoroheptan-2-ol |
| SMILES | CCCC[C@@H](Nc1nc(NCc2ccc(OC)cc2OC)nc2cccnc12)[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C23H28F3N5O3/c1-4-5-7-17(20(32)23(24,25)26)29-21-19-16(8-6-11-27-19)30-22(31-21)28-13-14-9-10-15(33-2)12-18(14)34-3/h6,8-12,17,20,32H,4-5,7,13H2,1-3H3,(H2,28,29,30,31)/t17-,20-/m1/s1 |
| InChIKey | DEFFVCSRRYOXDG-YLJYHZDGSA-N |
| XLogP | 4.55 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |