C23H30ClN5O3 — CID 122585284
(2R)-2-[[6-chloro-2-[(2,4-dimethoxyphenyl)methylamino]-8-methylpyrido[3,2-d]pyrimidin-4-yl]amino]hexan-1-ol (PubChem CID 122585284) has the molecular formula C23H30ClN5O3 and a molecular weight of 459.98 g/mol. Its IUPAC name is (2R)-2-[[6-chloro-2-[(2,4-dimethoxyphenyl)methylamino]-8-methylpyrido[3,2-d]pyrimidin-4-yl]amino]hexan-1-ol.
| Compound Name | (2R)-2-[[6-chloro-2-[(2,4-dimethoxyphenyl)methylamino]-8-methylpyrido[3,2-d]pyrimidin-4-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 122585284 |
| Molecular Formula | C23H30ClN5O3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (2R)-2-[[6-chloro-2-[(2,4-dimethoxyphenyl)methylamino]-8-methylpyrido[3,2-d]pyrimidin-4-yl]amino]hexan-1-ol |
| SMILES | CCCC[C@H](CO)Nc1nc(NCc2ccc(OC)cc2OC)nc2c(C)cc(Cl)nc12 |
| InChI | InChI=1S/C23H30ClN5O3/c1-5-6-7-16(13-30)26-22-21-20(14(2)10-19(24)27-21)28-23(29-22)25-12-15-8-9-17(31-3)11-18(15)32-4/h8-11,16,30H,5-7,12-13H2,1-4H3,(H2,25,26,28,29)/t16-/m1/s1 |
| InChIKey | VXPVNQPFPUJOLM-MRXNPFEDSA-N |
| XLogP | 4.58 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|