C12H22N4O2 — CID 155429580
2-[[5-methoxy-2-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol (PubChem CID 155429580) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[[5-methoxy-2-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol.
| Compound Name | 2-[[5-methoxy-2-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 155429580 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-[[5-methoxy-2-(methylamino)pyrimidin-4-yl]amino]hexan-1-ol |
| SMILES | CCCCC(CO)Nc1nc(NC)ncc1OC |
| InChI | InChI=1S/C12H22N4O2/c1-4-5-6-9(8-17)15-11-10(18-3)7-14-12(13-2)16-11/h7,9,17H,4-6,8H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | MRKKUGDWODATMF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |