C20H25N5O3 — CID 171084078
4-(butylamino)-2-[(2,4-dimethoxyphenyl)methylamino]-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 171084078) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-(butylamino)-2-[(2,4-dimethoxyphenyl)methylamino]-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 4-(butylamino)-2-[(2,4-dimethoxyphenyl)methylamino]-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 171084078 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-(butylamino)-2-[(2,4-dimethoxyphenyl)methylamino]-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCCCNc1nc(NCc2ccc(OC)cc2OC)nc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C20H25N5O3/c1-4-5-9-21-18-17-15(8-10-22-19(17)26)24-20(25-18)23-12-13-6-7-14(27-2)11-16(13)28-3/h6-8,10-11H,4-5,9,12H2,1-3H3,(H,22,26)(H2,21,23,24,25) |
| InChIKey | RXLQOFBFKOXWGI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|