C10H13N5O2 — CID 170185964
2-amino-4-(2-methoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 170185964) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-amino-4-(2-methoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(2-methoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 170185964 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-amino-4-(2-methoxyethylamino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | COCCNc1nc(N)nc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C10H13N5O2/c1-17-5-4-12-8-7-6(14-10(11)15-8)2-3-13-9(7)16/h2-3H,4-5H2,1H3,(H,13,16)(H3,11,12,14,15) |
| InChIKey | LKGCLQDVNLADFJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|