C8H13IN4O — CID 134094187
5-iodo-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 134094187) has the molecular formula C8H13IN4O and a molecular weight of 308.12 g/mol. Its IUPAC name is 5-iodo-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 5-iodo-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134094187 |
| Molecular Formula | C8H13IN4O |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 5-iodo-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(N)nc(C)c1I |
| InChI | InChI=1S/C8H13IN4O/c1-5-6(9)7(11-3-4-14-2)13-8(10)12-5/h3-4H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | NAIPKLWQKBCXDK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|