C11H13FN4O2 — CID 18507317
5-fluoro-6-(furan-2-yl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine (PubChem CID 18507317) has the molecular formula C11H13FN4O2 and a molecular weight of 252.25 g/mol. Its IUPAC name is 5-fluoro-6-(furan-2-yl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-6-(furan-2-yl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 18507317 |
| Molecular Formula | C11H13FN4O2 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-fluoro-6-(furan-2-yl)-4-N-(2-methoxyethyl)pyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(N)nc(-c2ccco2)c1F |
| InChI | InChI=1S/C11H13FN4O2/c1-17-6-4-14-10-8(12)9(15-11(13)16-10)7-3-2-5-18-7/h2-3,5H,4,6H2,1H3,(H3,13,14,15,16) |
| InChIKey | RWWKLPCJHNPDPP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|