C15H22N4O2 — CID 69095623
4-(2-methoxyethoxy)-6-pentylpyrido[3,2-d]pyrimidin-2-amine (PubChem CID 69095623) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-6-pentylpyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-(2-methoxyethoxy)-6-pentylpyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 69095623 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-(2-methoxyethoxy)-6-pentylpyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CCCCCc1ccc2nc(N)nc(OCCOC)c2n1 |
| InChI | InChI=1S/C15H22N4O2/c1-3-4-5-6-11-7-8-12-13(17-11)14(19-15(16)18-12)21-10-9-20-2/h7-8H,3-6,9-10H2,1-2H3,(H2,16,18,19) |
| InChIKey | BBCGIZFWYVSOMW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|