C12H17N5O2 — CID 15929244
1-(2-amino-4-butoxypteridin-6-yl)ethanol (PubChem CID 15929244) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(2-amino-4-butoxypteridin-6-yl)ethanol.
| Compound Name | 1-(2-amino-4-butoxypteridin-6-yl)ethanol |
|---|---|
| PubChem CID | 15929244 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-(2-amino-4-butoxypteridin-6-yl)ethanol |
| SMILES | CCCCOc1nc(N)nc2ncc(C(C)O)nc12 |
| InChI | InChI=1S/C12H17N5O2/c1-3-4-5-19-11-9-10(16-12(13)17-11)14-6-8(15-9)7(2)18/h6-7,18H,3-5H2,1-2H3,(H2,13,14,16,17) |
| InChIKey | ZKFUWXXEYWEDBR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|