C18H24N8O — CID 3025515
6-[4-[2-(diethylamino)ethoxy]phenyl]pteridine-2,4,7-triamine (PubChem CID 3025515) has the molecular formula C18H24N8O and a molecular weight of 368.45 g/mol. Its IUPAC name is 6-[4-[2-(diethylamino)ethoxy]phenyl]pteridine-2,4,7-triamine.
| Compound Name | 6-[4-[2-(diethylamino)ethoxy]phenyl]pteridine-2,4,7-triamine |
|---|---|
| PubChem CID | 3025515 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 6-[4-[2-(diethylamino)ethoxy]phenyl]pteridine-2,4,7-triamine |
| SMILES | CCN(CC)CCOc1ccc(-c2nc3c(N)nc(N)nc3nc2N)cc1 |
| InChI | InChI=1S/C18H24N8O/c1-3-26(4-2)9-10-27-12-7-5-11(6-8-12)13-15(19)23-17-14(22-13)16(20)24-18(21)25-17/h5-8H,3-4,9-10H2,1-2H3,(H6,19,20,21,23,24,25) |
| InChIKey | WYZBXZZUBRYGRC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |