C30H30ClNO — CID 160547333
2-[4-[3-(4-chlorophenyl)-5-phenylphenyl]phenoxy]-N,N-diethylethanamine (PubChem CID 160547333) has the molecular formula C30H30ClNO and a molecular weight of 456.03 g/mol. Its IUPAC name is 2-[4-[3-(4-chlorophenyl)-5-phenylphenyl]phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-[3-(4-chlorophenyl)-5-phenylphenyl]phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 160547333 |
| Molecular Formula | C30H30ClNO |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[4-[3-(4-chlorophenyl)-5-phenylphenyl]phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C30H30ClNO/c1-3-32(4-2)18-19-33-30-16-12-25(13-17-30)28-21-26(23-8-6-5-7-9-23)20-27(22-28)24-10-14-29(31)15-11-24/h5-17,20-22H,3-4,18-19H2,1-2H3 |
| InChIKey | QXPHUMMKELPDBX-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |