C20H27NO — CID 141121125
2-(3,5-dimethyl-4-phenylphenoxy)-N,N-diethylethanamine (PubChem CID 141121125) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-phenylphenoxy)-N,N-diethylethanamine.
| Compound Name | 2-(3,5-dimethyl-4-phenylphenoxy)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 141121125 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-(3,5-dimethyl-4-phenylphenoxy)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1cc(C)c(-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H27NO/c1-5-21(6-2)12-13-22-19-14-16(3)20(17(4)15-19)18-10-8-7-9-11-18/h7-11,14-15H,5-6,12-13H2,1-4H3 |
| InChIKey | KPEYKJARABAZJL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |