C26H31NO2 — CID 175517595
1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-phenylphenyl)ethanol (PubChem CID 175517595) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-phenylphenyl)ethanol.
| Compound Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-phenylphenyl)ethanol |
|---|---|
| PubChem CID | 175517595 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-2-(4-phenylphenyl)ethanol |
| SMILES | CCN(CC)CCOc1ccc(C(O)Cc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H31NO2/c1-3-27(4-2)18-19-29-25-16-14-24(15-17-25)26(28)20-21-10-12-23(13-11-21)22-8-6-5-7-9-22/h5-17,26,28H,3-4,18-20H2,1-2H3 |
| InChIKey | OLCQWGOJUDPLDE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |