C34H46N2O2 — CID 24967269
2-[4-[1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylbut-3-enyl]phenoxy]-N,N-diethylethanamine (PubChem CID 24967269) has the molecular formula C34H46N2O2 and a molecular weight of 514.75 g/mol. Its IUPAC name is 2-[4-[1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylbut-3-enyl]phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-[1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylbut-3-enyl]phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 24967269 |
| Molecular Formula | C34H46N2O2 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | 2-[4-[1-[4-[2-(diethylamino)ethoxy]phenyl]-2-phenylbut-3-enyl]phenoxy]-N,N-diethylethanamine |
| SMILES | C=CC(c1ccccc1)C(c1ccc(OCCN(CC)CC)cc1)c1ccc(OCCN(CC)CC)cc1 |
| InChI | InChI=1S/C34H46N2O2/c1-6-33(28-14-12-11-13-15-28)34(29-16-20-31(21-17-29)37-26-24-35(7-2)8-3)30-18-22-32(23-19-30)38-27-25-36(9-4)10-5/h6,11-23,33-34H,1,7-10,24-27H2,2-5H3 |
| InChIKey | IHMQAJKYZVGFRY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|