C27H33NO3 — CID 21128725
2-[4-[2-(diethylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)-1-phenylethanol (PubChem CID 21128725) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)-1-phenylethanol.
| Compound Name | 2-[4-[2-(diethylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)-1-phenylethanol |
|---|---|
| PubChem CID | 21128725 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 2-[4-[2-(diethylamino)ethoxy]phenyl]-1-(4-methoxyphenyl)-1-phenylethanol |
| SMILES | CCN(CC)CCOc1ccc(CC(O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H33NO3/c1-4-28(5-2)19-20-31-26-15-11-22(12-16-26)21-27(29,23-9-7-6-8-10-23)24-13-17-25(30-3)18-14-24/h6-18,29H,4-5,19-21H2,1-3H3 |
| InChIKey | KBHWKENESQQXIY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |