C23H29Cl2NO — CID 54113039
2-[4-(2,2-dichloro-1,3-dimethyl-3-phenylcyclopropyl)phenoxy]-N,N-diethylethanamine (PubChem CID 54113039) has the molecular formula C23H29Cl2NO and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-[4-(2,2-dichloro-1,3-dimethyl-3-phenylcyclopropyl)phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-(2,2-dichloro-1,3-dimethyl-3-phenylcyclopropyl)phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 54113039 |
| Molecular Formula | C23H29Cl2NO |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[4-(2,2-dichloro-1,3-dimethyl-3-phenylcyclopropyl)phenoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(C2(C)C(Cl)(Cl)C2(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H29Cl2NO/c1-5-26(6-2)16-17-27-20-14-12-19(13-15-20)22(4)21(3,23(22,24)25)18-10-8-7-9-11-18/h7-15H,5-6,16-17H2,1-4H3 |
| InChIKey | NIKODSLHKLULHU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|