C14H15N7 — CID 125484319
6-(3,4-dimethylphenyl)pteridine-2,4,7-triamine (PubChem CID 125484319) has the molecular formula C14H15N7 and a molecular weight of 281.32 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)pteridine-2,4,7-triamine.
| Compound Name | 6-(3,4-dimethylphenyl)pteridine-2,4,7-triamine |
|---|---|
| PubChem CID | 125484319 |
| Molecular Formula | C14H15N7 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6-(3,4-dimethylphenyl)pteridine-2,4,7-triamine |
| SMILES | Cc1ccc(-c2nc3c(N)nc(N)nc3nc2N)cc1C |
| InChI | InChI=1S/C14H15N7/c1-6-3-4-8(5-7(6)2)9-11(15)19-13-10(18-9)12(16)20-14(17)21-13/h3-5H,1-2H3,(H6,15,16,17,19,20,21) |
| InChIKey | UIEADXYCWUGRIH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |