C15H14N6O3 — CID 134112689
methyl 4-[(2,4-diaminopteridin-6-yl)methoxy]benzoate (PubChem CID 134112689) has the molecular formula C15H14N6O3 and a molecular weight of 326.32 g/mol. Its IUPAC name is methyl 4-[(2,4-diaminopteridin-6-yl)methoxy]benzoate.
| Compound Name | methyl 4-[(2,4-diaminopteridin-6-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 134112689 |
| Molecular Formula | C15H14N6O3 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | methyl 4-[(2,4-diaminopteridin-6-yl)methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C15H14N6O3/c1-23-14(22)8-2-4-10(5-3-8)24-7-9-6-18-13-11(19-9)12(16)20-15(17)21-13/h2-6H,7H2,1H3,(H4,16,17,18,20,21) |
| InChIKey | WAPVTTQMSIYBBO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |