C15H14N10O — CID 15816439
4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl azide (PubChem CID 15816439) has the molecular formula C15H14N10O and a molecular weight of 350.35 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl azide.
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl azide |
|---|---|
| PubChem CID | 15816439 |
| Molecular Formula | C15H14N10O |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl azide |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C15H14N10O/c1-25(10-4-2-8(3-5-10)14(26)23-24-18)7-9-6-19-13-11(20-9)12(16)21-15(17)22-13/h2-6H,7H2,1H3,(H4,16,17,19,21,22) |
| InChIKey | WKMYLFXUXKVFCX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|