C21H20N8O — CID 173093936
4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-phenylbenzamide (PubChem CID 173093936) has the molecular formula C21H20N8O and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-phenylbenzamide.
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 173093936 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-phenylbenzamide |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N8O/c1-29(12-15-11-24-19-17(25-15)18(22)27-21(23)28-19)16-9-7-13(8-10-16)20(30)26-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,26,30)(H4,22,23,24,27,28) |
| InChIKey | YMYWGECQVLFQIY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |