C20H24N8O2 — CID 91317272
4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-(5-oxopentan-2-yl)benzamide (PubChem CID 91317272) has the molecular formula C20H24N8O2 and a molecular weight of 408.47 g/mol. Its IUPAC name is 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-(5-oxopentan-2-yl)benzamide.
| Compound Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-(5-oxopentan-2-yl)benzamide |
|---|---|
| PubChem CID | 91317272 |
| Molecular Formula | C20H24N8O2 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]-N-(5-oxopentan-2-yl)benzamide |
| SMILES | CC(CCC=O)NC(=O)c1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C20H24N8O2/c1-12(4-3-9-29)24-19(30)13-5-7-15(8-6-13)28(2)11-14-10-23-18-16(25-14)17(21)26-20(22)27-18/h5-10,12H,3-4,11H2,1-2H3,(H,24,30)(H4,21,22,23,26,27) |
| InChIKey | UJMUQPDWFVFGLN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|