C28H32N10O4 — CID 167023336
5-amino-2-[[(4R)-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentyl]carbamoyl]benzoic acid (PubChem CID 167023336) has the molecular formula C28H32N10O4 and a molecular weight of 572.63 g/mol. Its IUPAC name is 5-amino-2-[[(4R)-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentyl]carbamoyl]benzoic acid.
| Compound Name | 5-amino-2-[[(4R)-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 167023336 |
| Molecular Formula | C28H32N10O4 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 5-amino-2-[[(4R)-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentyl]carbamoyl]benzoic acid |
| SMILES | C[C@H](CCCNC(=O)c1ccc(N)cc1C(=O)O)NC(=O)c1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C28H32N10O4/c1-15(4-3-11-32-26(40)20-10-7-17(29)12-21(20)27(41)42)34-25(39)16-5-8-19(9-6-16)38(2)14-18-13-33-24-22(35-18)23(30)36-28(31)37-24/h5-10,12-13,15H,3-4,11,14,29H2,1-2H3,(H,32,40)(H,34,39)(H,41,42)(H4,30,31,33,36,37)/t15-/m1/s1 |
| InChIKey | LQEGYZIZIIZBEP-OAHLLOKOSA-N |
| XLogP | 1.83 |
| TPSA | 228.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|