C26H34N10O6 — CID 10438247
(2S)-2-amino-6-[[(4R)-4-carboxy-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoyl]amino]hexanoic acid (PubChem CID 10438247) has the molecular formula C26H34N10O6 and a molecular weight of 582.62 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(4R)-4-carboxy-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[(4R)-4-carboxy-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 10438247 |
| Molecular Formula | C26H34N10O6 |
| Molecular Weight | 582.62 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | (2S)-2-amino-6-[[(4R)-4-carboxy-4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]butanoyl]amino]hexanoic acid |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@H](CCC(=O)NCCCC[C@H](N)C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C26H34N10O6/c1-36(13-15-12-31-22-20(32-15)21(28)34-26(29)35-22)16-7-5-14(6-8-16)23(38)33-18(25(41)42)9-10-19(37)30-11-3-2-4-17(27)24(39)40/h5-8,12,17-18H,2-4,9-11,13,27H2,1H3,(H,30,37)(H,33,38)(H,39,40)(H,41,42)(H4,28,29,31,34,35)/t17-,18+/m0/s1 |
| InChIKey | CLZYYSADWQNCNF-ZWKOTPCHSA-N |
| XLogP | -0.12 |
| TPSA | 265.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.62 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|