C24H31N9O4 — CID 165342272
(2S)-5-(butylamino)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-oxopentanoic acid (PubChem CID 165342272) has the molecular formula C24H31N9O4 and a molecular weight of 509.57 g/mol. Its IUPAC name is (2S)-5-(butylamino)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-(butylamino)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 165342272 |
| Molecular Formula | C24H31N9O4 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | (2S)-5-(butylamino)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-oxopentanoic acid |
| SMILES | CCCCNC(=O)CC[C@H](NC(=O)c1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C24H31N9O4/c1-3-4-11-27-18(34)10-9-17(23(36)37)30-22(35)14-5-7-16(8-6-14)33(2)13-15-12-28-21-19(29-15)20(25)31-24(26)32-21/h5-8,12,17H,3-4,9-11,13H2,1-2H3,(H,27,34)(H,30,35)(H,36,37)(H4,25,26,28,31,32)/t17-/m0/s1 |
| InChIKey | IXYGGLUCHPULKZ-KRWDZBQOSA-N |
| XLogP | 1.10 |
| TPSA | 202.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|