C26H30N10O2 — CID 167023064
N-[(2R)-5-(4-aminoanilino)pentan-2-yl]-4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzamide (PubChem CID 167023064) has the molecular formula C26H30N10O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is N-[(2R)-5-(4-aminoanilino)pentan-2-yl]-4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzamide.
| Compound Name | N-[(2R)-5-(4-aminoanilino)pentan-2-yl]-4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzamide |
|---|---|
| PubChem CID | 167023064 |
| Molecular Formula | C26H30N10O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-[(2R)-5-(4-aminoanilino)pentan-2-yl]-4-[(2,4-diaminopteridin-6-yl)methyl-formylamino]benzamide |
| SMILES | C[C@H](CCCNc1ccc(N)cc1)NC(=O)c1ccc(N(C=O)Cc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C26H30N10O2/c1-16(3-2-12-30-19-8-6-18(27)7-9-19)32-25(38)17-4-10-21(11-5-17)36(15-37)14-20-13-31-24-22(33-20)23(28)34-26(29)35-24/h4-11,13,15-16,30H,2-3,12,14,27H2,1H3,(H,32,38)(H4,28,29,31,34,35)/t16-/m1/s1 |
| InChIKey | WVVMSTNIYBSXKW-MRXNPFEDSA-N |
| XLogP | 2.34 |
| TPSA | 191.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|