C30H35N9O4 — CID 164741188
(2S)-5-[(4-tert-butylbenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid (PubChem CID 164741188) has the molecular formula C30H35N9O4 and a molecular weight of 585.67 g/mol. Its IUPAC name is (2S)-5-[(4-tert-butylbenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-[(4-tert-butylbenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 164741188 |
| Molecular Formula | C30H35N9O4 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | (2S)-5-[(4-tert-butylbenzoyl)amino]-2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC[C@H](NC(=O)c2ccc(NCc3cnc4nc(N)nc(N)c4n3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C30H35N9O4/c1-30(2,3)19-10-6-17(7-11-19)26(40)33-14-4-5-22(28(42)43)37-27(41)18-8-12-20(13-9-18)34-15-21-16-35-25-23(36-21)24(31)38-29(32)39-25/h6-13,16,22,34H,4-5,14-15H2,1-3H3,(H,33,40)(H,37,41)(H,42,43)(H4,31,32,35,38,39)/t22-/m0/s1 |
| InChIKey | DDUPOYXLSDPZJD-QFIPXVFZSA-N |
| XLogP | 2.89 |
| TPSA | 211.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|