C21H23ClN8O6 — CID 139392161
acetyl chloride;2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid (PubChem CID 139392161) has the molecular formula C21H23ClN8O6 and a molecular weight of 518.92 g/mol. Its IUPAC name is acetyl chloride;2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid.
| Compound Name | acetyl chloride;2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 139392161 |
| Molecular Formula | C21H23ClN8O6 |
| Molecular Weight | 518.92 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | acetyl chloride;2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| SMILES | CC(=O)Cl.Nc1nc(N)c2nc(CNc3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C19H20N8O5.C2H3ClO/c20-15-14-16(27-19(21)26-15)23-8-11(24-14)7-22-10-3-1-9(2-4-10)17(30)25-12(18(31)32)5-6-13(28)29;1-2(3)4/h1-4,8,12,22H,5-7H2,(H,25,30)(H,28,29)(H,31,32)(H4,20,21,23,26,27);1H3 |
| InChIKey | OKAVPMJJGQIWLX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 236.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.92 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|