C20H21N7O5 — CID 15950455
2-[2-[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]-2-oxoethyl]pentanedioic acid (PubChem CID 15950455) has the molecular formula C20H21N7O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-[2-[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]-2-oxoethyl]pentanedioic acid.
| Compound Name | 2-[2-[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]-2-oxoethyl]pentanedioic acid |
|---|---|
| PubChem CID | 15950455 |
| Molecular Formula | C20H21N7O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[2-[4-[(2,4-diaminopteridin-6-yl)methylamino]phenyl]-2-oxoethyl]pentanedioic acid |
| SMILES | Nc1nc(N)c2nc(CNc3ccc(C(=O)CC(CCC(=O)O)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C20H21N7O5/c21-17-16-18(27-20(22)26-17)24-9-13(25-16)8-23-12-4-1-10(2-5-12)14(28)7-11(19(31)32)3-6-15(29)30/h1-2,4-5,9,11,23H,3,6-8H2,(H,29,30)(H,31,32)(H4,21,22,24,26,27) |
| InChIKey | LRFMLHUPQULXRR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 207.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |