C22H24N6O4 — CID 157390870
(2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-oxohexanoic acid (PubChem CID 157390870) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is (2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-oxohexanoic acid.
| Compound Name | (2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 157390870 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (2R)-2-[2-[4-[2-(2,4-diaminopteridin-6-yl)ethyl]phenyl]-2-oxoethyl]-5-oxohexanoic acid |
| SMILES | CC(=O)CC[C@H](CC(=O)c1ccc(CCc2cnc3nc(N)nc(N)c3n2)cc1)C(=O)O |
| InChI | InChI=1S/C22H24N6O4/c1-12(29)2-6-15(21(31)32)10-17(30)14-7-3-13(4-8-14)5-9-16-11-25-20-18(26-16)19(23)27-22(24)28-20/h3-4,7-8,11,15H,2,5-6,9-10H2,1H3,(H,31,32)(H4,23,24,25,27,28)/t15-/m1/s1 |
| InChIKey | VONGXOKAHFZECX-OAHLLOKOSA-N |
| XLogP | 2.01 |
| TPSA | 175.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |