C28H30N8O4 — CID 166938204
(2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-[(4-methylbenzoyl)amino]pentanoic acid (PubChem CID 166938204) has the molecular formula C28H30N8O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is (2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-[(4-methylbenzoyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-[(4-methylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 166938204 |
| Molecular Formula | C28H30N8O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | (2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-[(4-methylbenzoyl)amino]pentanoic acid |
| SMILES | Cc1ccc(C(=O)NCCC[C@H](NC(=O)c2ccc(CCc3cnc4nc(N)nc(N)c4n3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C28H30N8O4/c1-16-4-9-18(10-5-16)25(37)31-14-2-3-21(27(39)40)34-26(38)19-11-6-17(7-12-19)8-13-20-15-32-24-22(33-20)23(29)35-28(30)36-24/h4-7,9-12,15,21H,2-3,8,13-14H2,1H3,(H,31,37)(H,34,38)(H,39,40)(H4,29,30,32,35,36)/t21-/m0/s1 |
| InChIKey | QWLDFNSTRHHZNT-NRFANRHFSA-N |
| XLogP | 2.07 |
| TPSA | 199.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|