C29H28N8O5 — CID 10507237
methyl 2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 10507237) has the molecular formula C29H28N8O5 and a molecular weight of 568.59 g/mol. Its IUPAC name is methyl 2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | methyl 2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 10507237 |
| Molecular Formula | C29H28N8O5 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | methyl 2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | COC(=O)C(CCCN1C(=O)c2ccccc2C1=O)NC(=O)c1ccc(CCc2cnc3nc(N)nc(N)c3n2)cc1 |
| InChI | InChI=1S/C29H28N8O5/c1-42-28(41)21(7-4-14-37-26(39)19-5-2-3-6-20(19)27(37)40)34-25(38)17-11-8-16(9-12-17)10-13-18-15-32-24-22(33-18)23(30)35-29(31)36-24/h2-3,5-6,8-9,11-12,15,21H,4,7,10,13-14H2,1H3,(H,34,38)(H4,30,31,32,35,36) |
| InChIKey | VKVMSPUFXGRQAP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 196.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|