C30H28N8O6 — CID 10603596
methyl (2S)-2-[[4-[(2,4-diaminopyrido[2,3-d]pyrimidin-6-yl)methyl-formylamino]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 10603596) has the molecular formula C30H28N8O6 and a molecular weight of 596.60 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(2,4-diaminopyrido[2,3-d]pyrimidin-6-yl)methyl-formylamino]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | methyl (2S)-2-[[4-[(2,4-diaminopyrido[2,3-d]pyrimidin-6-yl)methyl-formylamino]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 10603596 |
| Molecular Formula | C30H28N8O6 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | methyl (2S)-2-[[4-[(2,4-diaminopyrido[2,3-d]pyrimidin-6-yl)methyl-formylamino]benzoyl]amino]-5-(1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | COC(=O)[C@H](CCCN1C(=O)c2ccccc2C1=O)NC(=O)c1ccc(N(C=O)Cc2cnc3nc(N)nc(N)c3c2)cc1 |
| InChI | InChI=1S/C30H28N8O6/c1-44-29(43)23(7-4-12-38-27(41)20-5-2-3-6-21(20)28(38)42)34-26(40)18-8-10-19(11-9-18)37(16-39)15-17-13-22-24(31)35-30(32)36-25(22)33-14-17/h2-3,5-6,8-11,13-14,16,23H,4,7,12,15H2,1H3,(H,34,40)(H4,31,32,33,35,36)/t23-/m0/s1 |
| InChIKey | LWUAQCAKXATCGF-QHCPKHFHSA-N |
| XLogP | 1.70 |
| TPSA | 203.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|