C30H33N9O8 — CID 137058166
methyl 2-[[4-[[2-(dimethylaminomethylideneamino)-4-oxo-3H-pteridin-6-yl]methyl-formylamino]benzoyl]amino]-5-[(1-methoxy-1-oxopent-4-yn-2-yl)amino]-5-oxopentanoate (PubChem CID 137058166) has the molecular formula C30H33N9O8 and a molecular weight of 647.65 g/mol. Its IUPAC name is methyl 2-[[4-[[2-(dimethylaminomethylideneamino)-4-oxo-3H-pteridin-6-yl]methyl-formylamino]benzoyl]amino]-5-[(1-methoxy-1-oxopent-4-yn-2-yl)amino]-5-oxopentanoate.
| Compound Name | methyl 2-[[4-[[2-(dimethylaminomethylideneamino)-4-oxo-3H-pteridin-6-yl]methyl-formylamino]benzoyl]amino]-5-[(1-methoxy-1-oxopent-4-yn-2-yl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 137058166 |
| Molecular Formula | C30H33N9O8 |
| Molecular Weight | 647.65 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | methyl 2-[[4-[[2-(dimethylaminomethylideneamino)-4-oxo-3H-pteridin-6-yl]methyl-formylamino]benzoyl]amino]-5-[(1-methoxy-1-oxopent-4-yn-2-yl)amino]-5-oxopentanoate |
| SMILES | C#CCC(NC(=O)CCC(NC(=O)c1ccc(N(C=O)Cc2cnc3nc(N=CN(C)C)[nH]c(=O)c3n2)cc1)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C30H33N9O8/c1-6-7-21(28(44)46-4)34-23(41)13-12-22(29(45)47-5)35-26(42)18-8-10-20(11-9-18)39(17-40)15-19-14-31-25-24(33-19)27(43)37-30(36-25)32-16-38(2)3/h1,8-11,14,16-17,21-22H,7,12-13,15H2,2-5H3,(H,34,41)(H,35,42)(H,31,36,37,43) |
| InChIKey | AVELSAUATRWKIP-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 218.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.65 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|