C34H34N8O5 — CID 13143496
dibenzyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate (PubChem CID 13143496) has the molecular formula C34H34N8O5 and a molecular weight of 634.70 g/mol. Its IUPAC name is dibenzyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate.
| Compound Name | dibenzyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 13143496 |
| Molecular Formula | C34H34N8O5 |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | dibenzyl 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H34N8O5/c1-42(19-25-18-37-31-29(38-25)30(35)40-34(36)41-31)26-14-12-24(13-15-26)32(44)39-27(33(45)47-21-23-10-6-3-7-11-23)16-17-28(43)46-20-22-8-4-2-5-9-22/h2-15,18,27H,16-17,19-21H2,1H3,(H,39,44)(H4,35,36,37,40,41) |
| InChIKey | VQIPKIZPEATZLC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 188.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |