C28H32N10O5 — CID 70810322
4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-[[4-(hydrazinylmethyl)phenyl]methoxy]-5-oxopentanoic acid (PubChem CID 70810322) has the molecular formula C28H32N10O5 and a molecular weight of 588.63 g/mol. Its IUPAC name is 4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-[[4-(hydrazinylmethyl)phenyl]methoxy]-5-oxopentanoic acid.
| Compound Name | 4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-[[4-(hydrazinylmethyl)phenyl]methoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70810322 |
| Molecular Formula | C28H32N10O5 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 4-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]-5-[[4-(hydrazinylmethyl)phenyl]methoxy]-5-oxopentanoic acid |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCC(=O)O)C(=O)OCc2ccc(CNN)cc2)cc1 |
| InChI | InChI=1S/C28H32N10O5/c1-38(14-19-13-32-25-23(34-19)24(29)36-28(30)37-25)20-8-6-18(7-9-20)26(41)35-21(10-11-22(39)40)27(42)43-15-17-4-2-16(3-5-17)12-33-31/h2-9,13,21,33H,10-12,14-15,31H2,1H3,(H,35,41)(H,39,40)(H4,29,30,32,36,37) |
| InChIKey | FMWHQENZVNOCJE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 237.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|