C24H26KN7O5 — CID 144564588
potassium;but-1-yne;(2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-hydroxy-5-oxopentanoate (PubChem CID 144564588) has the molecular formula C24H26KN7O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is potassium;but-1-yne;(2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-hydroxy-5-oxopentanoate.
| Compound Name | potassium;but-1-yne;(2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 144564588 |
| Molecular Formula | C24H26KN7O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | potassium;but-1-yne;(2S)-2-[[4-[2-(2,4-diaminopteridin-6-yl)ethyl]benzoyl]amino]-5-hydroxy-5-oxopentanoate |
| SMILES | C#CCC.Nc1nc(N)c2nc(CCc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)[O-])cc3)cnc2n1.[K+] |
| InChI | InChI=1S/C20H21N7O5.C4H6.K/c21-16-15-17(27-20(22)26-16)23-9-12(24-15)6-3-10-1-4-11(5-2-10)18(30)25-13(19(31)32)7-8-14(28)29;1-3-4-2;/h1-2,4-5,9,13H,3,6-8H2,(H,25,30)(H,28,29)(H,31,32)(H4,21,22,23,26,27);1H,4H2,2H3;/q;;+1/p-1/t13-;;/m0../s1 |
| InChIKey | PURHLTKDNXKOAP-GXKRWWSZSA-M |
| XLogP | -2.88 |
| TPSA | 210.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|