C24H25N7O5 — CID 118201161
(2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 118201161) has the molecular formula C24H25N7O5 and a molecular weight of 491.51 g/mol. Its IUPAC name is (2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 118201161 |
| Molecular Formula | C24H25N7O5 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (2S)-2-[[4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | C#CCC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)N[C@@H](CCC(=O)OC)C(=O)O)cc1 |
| InChI | InChI=1S/C24H25N7O5/c1-3-4-15(11-16-12-27-21-19(28-16)20(25)30-24(26)31-21)13-5-7-14(8-6-13)22(33)29-17(23(34)35)9-10-18(32)36-2/h1,5-8,12,15,17H,4,9-11H2,2H3,(H,29,33)(H,34,35)(H4,25,26,27,30,31)/t15?,17-/m0/s1 |
| InChIKey | DEQSCDRJDRKCBK-LWKPJOBUSA-N |
| XLogP | 1.07 |
| TPSA | 196.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|